Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(3-Cyanophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]benzamide
ID: Reference11430
Other Names:
D-Arabinitol, 1,4-anhydro-5-(benzoylamino)-2-[[(3-cyanophenyl)methyl]amino]-2,5-dideoxy-;
NAT19-551436
Formula: C20H21N3O3
1,4-Anhydro-5-(benzoylamino)-2-[(3-cyanobenzyl)amino]-2,5-dideoxy-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1660 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/3/2022 2:54:35 PM |
| InChI | InChI=1S/C20H21N3O3/c21-10-14-5-4-6-15(9-14)11-22-17-13-26-18(19(17)24)12-23-20(25)16-7-2-1-3-8-16/h1-9,17-19,22,24H,11-13H2,(H,23,25)/t17-,18-,19+/m1/s1 |
| InChI Key | MDEBTWXTICHSAP-QRVBRYPASA-N |
| Canonical SMILES | C1C(C(C(O1)CNC(=O)C2=CC=CC=C2)O)NCC3=CC(=CC=C3)C#N |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-5-(benzoylamino)-2-[[(3-cyanophenyl)methyl]amino]-2,5-dideoxy-; NAT19-551436 |