Systematic / IUPAC Name: (3S,3aR,6S,6aR)-6-N-[4-(3-Fluorophenyl)pyrimidin-2-yl]-3-N-(3-phenylpropyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diamine
ID: Reference11492
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[[4-(3-fluorophenyl)-2-pyrimidinyl]amino]-5-[(3-phenylpropyl)amino]-;
NAT6-324342
Formula: C25H27FN4O2
1,4:3,6-Dianhydro-2,5-dideoxy-2-{[4-(3-fluorophenyl)-2-pyrimidinyl]amino}-5-[(3-phenylpropyl)amino]-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2238 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 8:31:56 AM |
| InChI | InChI=1S/C25H27FN4O2/c26-19-10-4-9-18(14-19)20-11-13-28-25(29-20)30-22-16-32-23-21(15-31-24(22)23)27-12-5-8-17-6-2-1-3-7-17/h1-4,6-7,9-11,13-14,21-24,27H,5,8,12,15-16H2,(H,28,29,30)/t21-,22-,23+,24+/m0/s1 |
| InChI Key | UXSITIAPEVMRHB-CJRSTVEYSA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)NC3=NC=CC(=N3)C4=CC(=CC=C4)F)NCCCC5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[[4-(3-fluorophenyl)-2-pyrimidinyl]amino]-5-[(3-phenylpropyl)amino]-; NAT6-324342 |