Systematic / IUPAC Name: N'-(4-Ethylbenzoyl)-3,5-dimethyl-N-(2-methyl-2-propanyl)benzohydrazide
ID: Reference1150
Other Names:
Benzoic acid, 3,5-dimethyl, 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide;
1-tert-Butyl-1-(3,5-dimethylbenzoyl)-2-(4-ethylbenzoyl)hydrazine;
3,5-Dimethylbenzoic acid N-tert-butyl-N-(4-ethylbenzoyl)hydrazide;
3,5-Dimethyl-1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide benzoic acid;
N-(tert-Butyl)(3,5-dimethylphenyl)-N-[(4-ethylphenyl)carbonylamino]carboxamide
Formula: C22H28N2O2
Class: Pesticides/Herbicides
Tebufenozide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 3252 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/5/2014 9:41:36 AM |
| InChI | InChI=1S/C22H28N2O2/c1-7-17-8-10-18(11-9-17)20(25)23-24(22(4,5)6)21(26)19-13-15(2)12-16(3)14-19/h8-14H,7H2,1-6H3,(H,23,25) |
| InChI Key | QYPNKSZPJQQLRK-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=C(C=C1)C(=O)NN(C(=O)C2=CC(=CC(=C2)C)C)C(C)(C)C |
| CAS | 112410238 |
| Splash | |
| Other Names |
Benzoic acid, 3,5-dimethyl, 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide; 1-tert-Butyl-1-(3,5-dimethylbenzoyl)-2-(4-ethylbenzoyl)hydrazine; 3,5-Dimethylbenzoic acid N-tert-butyl-N-(4-ethylbenzoyl)hydrazide; 3,5-Dimethyl-1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide benzoic acid; N-(tert-Butyl)(3,5-dimethylphenyl)-N-[(4-ethylphenyl)carbonylamino]carboxamide; Confirm |
| ChEMBL | CHEMBL226968 |
| KEGG | C18526 |
| PubChem | 91773 |
| ChEBI | CHEBI:38452 |
| ChemIDPlus | EE4128503; 112410238; 142583695 |
| Wikipedia | Tebufenozide |
| ChemSpider | 82870 |