Systematic / IUPAC Name: N-[4-[[[(3R,4S,5R)-5-(Benzenesulfonamidomethyl)-4-hydroxyoxolan-3-yl]amino]methyl]phenyl]acetamide
ID: Reference11500
Other Names:
D-Arabinitol, 2-[[[4-(acetylamino)phenyl]methyl]amino]-1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-;
NAT19-551622
Formula: C20H25N3O5S
2-[(4-Acetamidobenzyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1394 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 2:22:53 PM |
| InChI | InChI=1S/C20H25N3O5S/c1-14(24)23-16-9-7-15(8-10-16)11-21-18-13-28-19(20(18)25)12-22-29(26,27)17-5-3-2-4-6-17/h2-10,18-22,25H,11-13H2,1H3,(H,23,24)/t18-,19-,20+/m1/s1 |
| InChI Key | UNQZYXDXNXZGCQ-AQNXPRMDSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CNC2COC(C2O)CNS(=O)(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-[[[4-(acetylamino)phenyl]methyl]amino]-1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-; NAT19-551622 |