Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(4-Acetamidophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]-3,3-dimethylbutanamide
ID: Reference11526
Other Names:
D-Arabinitol, 2-[[[4-(acetylamino)phenyl]methyl]amino]-1,4-anhydro-2,5-dideoxy-5-[(3,3-dimethyl-1-oxobutyl)amino]-;
NAT19-551072
Formula: C20H31N3O4
2-[(4-Acetamidobenzyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(3,3-dimethylbutanoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1193 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/6/2022 10:05:44 AM |
| InChI | InChI=1S/C20H31N3O4/c1-13(24)23-15-7-5-14(6-8-15)10-21-16-12-27-17(19(16)26)11-22-18(25)9-20(2,3)4/h5-8,16-17,19,21,26H,9-12H2,1-4H3,(H,22,25)(H,23,24)/t16-,17-,19+/m1/s1 |
| InChI Key | NDWFDIPYMBKMDB-LMMKCTJWSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)CNC2COC(C2O)CNC(=O)CC(C)(C)C |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-[[[4-(acetylamino)phenyl]methyl]amino]-1,4-anhydro-2,5-dideoxy-5-[(3,3-dimethyl-1-oxobutyl)amino]-; NAT19-551072 |