Systematic / IUPAC Name: 4-Amino-6-[(2-methyl-2-propanyl)amino]-1,3,5-triazin-2(5H)-one
ID: Reference1153
Other Names:
1,3,5-Triazin-2(1H)-one, 4-amino-6-[(1,1-dimethylethyl)amino]-;
4-Amino-2-hydroxy-6-tert-butylamino-1,3,5-triazine
Formula: C7H13N5O
Class: Pesticides/Herbicides
Terbuthylazine-desethyl-2-hydroxy mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 2 |
| No. of Spectra | 106 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2014 9:28:56 AM |
| InChI | InChI=1S/C7H13N5O/c1-7(2,3)12-5-9-4(8)10-6(13)11-5/h1-3H3,(H4,8,9,10,11,12,13) |
| InChI Key | NUISVCFZNCYUIM-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)NC1=NC(=O)N=C(N1)N |
| CAS | 66753079 |
| Splash | |
| Other Names |
1,3,5-Triazin-2(1H)-one, 4-amino-6-[(1,1-dimethylethyl)amino]-; 4-Amino-2-hydroxy-6-tert-butylamino-1,3,5-triazine |