Systematic / IUPAC Name: 1-[[(2R,3R,4S,5S)-4-Hydroxy-5-(hydroxymethyl)-3-(4-methylpiperazin-1-yl)oxolan-2-yl]methyl]-3-(3-methoxyphenyl)urea
ID: Reference11537
Other Names:
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[[(3-methoxyphenyl)amino]carbonyl]amino]-4-(4-methyl-1-piperazinyl)-;
NAT27-401327
Formula: C19H30N4O5
2,5-Anhydro-4,6-dideoxy-6-{[(3-methoxyphenyl)carbamoyl]amino}-4-(4-methyl-1-piperazinyl)-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1528 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/6/2022 2:15:30 PM |
| InChI | InChI=1S/C19H30N4O5/c1-22-6-8-23(9-7-22)17-15(28-16(12-24)18(17)25)11-20-19(26)21-13-4-3-5-14(10-13)27-2/h3-5,10,15-18,24-25H,6-9,11-12H2,1-2H3,(H2,20,21,26)/t15-,16+,17+,18-/m1/s1 |
| InChI Key | ZLVLAXIBJQTNPO-VSZNYVQBSA-N |
| Canonical SMILES | CN1CCN(CC1)C2C(OC(C2O)CO)CNC(=O)NC3=CC(=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names |
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[[(3-methoxyphenyl)amino]carbonyl]amino]-4-(4-methyl-1-piperazinyl)-; NAT27-401327 |