Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(4,4-Difluorocyclohexyl)amino]-3-hydroxyoxolan-2-yl]methyl]-4-fluorobenzamide
ID: Reference11565
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(4-fluorobenzoyl)amino]-;
NAT19-551463
Formula: C18H23F3N2O3
1,4-Anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(4-fluorobenzoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1715 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/15/2022 6:59:35 AM |
| InChI | InChI=1S/C18H23F3N2O3/c19-12-3-1-11(2-4-12)17(25)22-9-15-16(24)14(10-26-15)23-13-5-7-18(20,21)8-6-13/h1-4,13-16,23-24H,5-10H2,(H,22,25)/t14-,15-,16+/m1/s1 |
| InChI Key | DALUJPLJKMGNFM-OAGGEKHMSA-N |
| Canonical SMILES | C1CC(CCC1NC2COC(C2O)CNC(=O)C3=CC=C(C=C3)F)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(4,4-difluorocyclohexyl)amino]-5-[(4-fluorobenzoyl)amino]-; NAT19-551463 |