Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-[(2-Fluorophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide
ID: Reference11566
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(2-fluorophenyl)methyl]amino]-5-[(phenylsulfonyl)amino]-;
NAT19-551637
Formula: C18H21FN2O4S
1,4-Anhydro-2,5-dideoxy-2-[(2-fluorobenzyl)amino]-5-[(phenylsulfonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1174 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/15/2022 7:06:07 AM |
| InChI | InChI=1S/C18H21FN2O4S/c19-15-9-5-4-6-13(15)10-20-16-12-25-17(18(16)22)11-21-26(23,24)14-7-2-1-3-8-14/h1-9,16-18,20-22H,10-12H2/t16-,17-,18+/m1/s1 |
| InChI Key | UICZNDNCXOKGRG-KURKYZTESA-N |
| Canonical SMILES | C1C(C(C(O1)CNS(=O)(=O)C2=CC=CC=C2)O)NCC3=CC=CC=C3F |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(2-fluorophenyl)methyl]amino]-5-[(phenylsulfonyl)amino]-; NAT19-551637 |