Systematic / IUPAC Name: (4E)-3-[(2-Chloro-1,3-thiazol-5-yl)methyl]-5-methyl-N-nitro-1,3,5-oxadiazinan-4-imine
ID: Reference1157
Other Names:
3-[(2-Chloro-5-thiazolyl)methyl]tetrahydro-5-methyl-N-nitro-4H-1,3,5-oxadiazin-4-imine;
4H-1,3,5-Oxadiazin-4-imine, 3-[(2-chloro-5-thiazolyl)methyl]tetrahydro-5-methyl-N-nitro-
Formula: C8H10ClN5O3S
Class: Pesticides/Herbicides
Thiamethoxam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 172 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 6:54:41 AM |
| InChI | InChI=1S/C8H10ClN5O3S/c1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3/b11-8+ |
| InChI Key | NWWZPOKUUAIXIW-DHZHZOJOSA-N |
| Canonical SMILES | CN\1COCN(/C1=N/[N+](=O)[O-])CC2=CN=C(S2)Cl |
| CAS | 153719234 |
| Splash | |
| Other Names |
3-[(2-Chloro-5-thiazolyl)methyl]tetrahydro-5-methyl-N-nitro-4H-1,3,5-oxadiazin-4-imine; 4H-1,3,5-Oxadiazin-4-imine, 3-[(2-chloro-5-thiazolyl)methyl]tetrahydro-5-methyl-N-nitro- |
| ChemIDPlus | 153719234 |
| ChEBI | CHEBI:39186 |
| Wikipedia | Thiamethoxam |
| ChemSpider | 4712649 |
| KEGG | C18513 |
| PubChem | 5821911 |