Systematic / IUPAC Name: 2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol
ID: Reference1159
Other Names:
Cyclohexanol, 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)-;
2-Dimethylaminomethyl-1-(m-methoxyphenyl)cyclohexanol;
Cyclohexanol, 2-(dimethylaminomethyl)-1-(m-methoxyphenyl)-;
Ultram
Formula: C16H25NO2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
Tramadol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 98 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2015 1:58:05 PM |
| InChI | InChI=1S/C16H25NO2/c1-17(2)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)19-3/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3 |
| InChI Key | TVYLLZQTGLZFBW-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)CC1CCCCC1(C2=CC(=CC=C2)OC)O |
| CAS | 27203925 |
| Splash | |
| Other Names |
Cyclohexanol, 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)-; 2-Dimethylaminomethyl-1-(m-methoxyphenyl)cyclohexanol; Cyclohexanol, 2-(dimethylaminomethyl)-1-(m-methoxyphenyl)-; Ultram |
| ChEMBL | CHEMBL1237044 |
| KEGG | C07153 |
| PubChem | 5523 |
| ChemSpider | 5322 |
| ChEBI | CHEBI:75722 |
| ChemIDPlus | 022204882; 123134258; 123154381; 002914774 |
| Wikipedia | Tramadol |