Systematic / IUPAC Name: N-[[(2R,3R,4S,5S)-4-Hydroxy-5-(hydroxymethyl)-3-(4-phenylpiperazin-1-yl)oxolan-2-yl]methyl]thiophene-2-carboxamide
ID: Reference11600
Other Names:
D-Galactitol, 2,5-anhydro-4,6-dideoxy-4-(4-phenyl-1-piperazinyl)-6-[(2-thienylcarbonyl)amino]-;
NAT27-401046
Formula: C21H27N3O4S
2,5-Anhydro-4,6-dideoxy-4-(4-phenyl-1-piperazinyl)-6-[(2-thienylcarbonyl)amino]-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2084 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/1/2022 9:11:55 AM |
| InChI | InChI=1S/C21H27N3O4S/c25-14-17-20(26)19(16(28-17)13-22-21(27)18-7-4-12-29-18)24-10-8-23(9-11-24)15-5-2-1-3-6-15/h1-7,12,16-17,19-20,25-26H,8-11,13-14H2,(H,22,27)/t16-,17+,19+,20-/m1/s1 |
| InChI Key | ACSXWXDHNBHLIB-LCLWPZTBSA-N |
| Canonical SMILES | C1CN(CCN1C2C(OC(C2O)CO)CNC(=O)C3=CC=CS3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
D-Galactitol, 2,5-anhydro-4,6-dideoxy-4-(4-phenyl-1-piperazinyl)-6-[(2-thienylcarbonyl)amino]-; NAT27-401046 |