Systematic / IUPAC Name: N-[[(2R,3S,4R)-3-Hydroxy-4-(propan-2-ylamino)oxolan-2-yl]methyl]pyridine-4-carboxamide
ID: Reference11621
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(1-methylethyl)amino]-5-[(4-pyridinylcarbonyl)amino]-;
NAT19-553964
Formula: C14H21N3O3
1,4-Anhydro-2,5-dideoxy-5-(isonicotinoylamino)-2-(isopropylamino)-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 605 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/2/2022 8:13:44 AM |
| InChI | InChI=1S/C14H21N3O3/c1-9(2)17-11-8-20-12(13(11)18)7-16-14(19)10-3-5-15-6-4-10/h3-6,9,11-13,17-18H,7-8H2,1-2H3,(H,16,19)/t11-,12-,13+/m1/s1 |
| InChI Key | CZDBXBFJVFJALS-UPJWGTAASA-N |
| Canonical SMILES | CC(C)NC1COC(C1O)CNC(=O)C2=CC=NC=C2 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(1-methylethyl)amino]-5-[(4-pyridinylcarbonyl)amino]-; NAT19-553964 |