Systematic / IUPAC Name: 1-[[(2R,3S,4R)-4-(2,2-Dimethylpropylamino)-3-hydroxyoxolan-2-yl]methyl]-3-propan-2-ylurea
ID: Reference11676
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(2,2-dimethylpropyl)amino]-5-[[[(1-methylethyl)amino]carbonyl]amino]-;
NAT19-551714
Formula: C14H29N3O3
1,4-Anhydro-2,5-dideoxy-2-[(2,2-dimethylpropyl)amino]-5-[(isopropylcarbamoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 605 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/19/2022 7:33:23 AM |
| InChI | InChI=1S/C14H29N3O3/c1-9(2)17-13(19)15-6-11-12(18)10(7-20-11)16-8-14(3,4)5/h9-12,16,18H,6-8H2,1-5H3,(H2,15,17,19)/t10-,11-,12+/m1/s1 |
| InChI Key | DBORYZNCTWQGJB-UTUOFQBUSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(CO1)NCC(C)(C)C)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[(2,2-dimethylpropyl)amino]-5-[[[(1-methylethyl)amino]carbonyl]amino]-; NAT19-551714 |