Systematic / IUPAC Name: 1-[[(2R,3S,4R)-3-Hydroxy-4-(oxetan-3-ylamino)oxolan-2-yl]methyl]-3-propan-2-ylurea
ID: Reference11685
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[[[(1-methylethyl)amino]carbonyl]amino]-2-(3-oxetanylamino)-;
NAT19-554055
Formula: C12H23N3O4
1,4-Anhydro-2,5-dideoxy-5-[(isopropylcarbamoyl)amino]-2-(3-oxetanylamino)-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 530 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/23/2022 1:04:07 PM |
| InChI | InChI=1S/C12H23N3O4/c1-7(2)14-12(17)13-3-10-11(16)9(6-19-10)15-8-4-18-5-8/h7-11,15-16H,3-6H2,1-2H3,(H2,13,14,17)/t9-,10-,11+/m1/s1 |
| InChI Key | DEZYQZZUPCLADY-MXWKQRLJSA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(CO1)NC2COC2)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[[[(1-methylethyl)amino]carbonyl]amino]-2-(3-oxetanylamino)-; NAT19-554055 |