Systematic / IUPAC Name: 1-[[(2R,3S,4R)-4-[(1-Acetylpiperidin-4-yl)amino]-3-hydroxyoxolan-2-yl]methyl]-3-propan-2-ylurea
ID: Reference11687
Other Names:
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[[[(1-methylethyl)amino]carbonyl]amino]-;
NAT19-551711
Formula: C16H30N4O4
2-[(1-Acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[(isopropylcarbamoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1221 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/23/2022 1:09:17 PM |
| InChI | InChI=1S/C16H30N4O4/c1-10(2)18-16(23)17-8-14-15(22)13(9-24-14)19-12-4-6-20(7-5-12)11(3)21/h10,12-15,19,22H,4-9H2,1-3H3,(H2,17,18,23)/t13-,14-,15+/m1/s1 |
| InChI Key | IWIYSLSCOMVWSC-KFWWJZLASA-N |
| Canonical SMILES | CC(C)NC(=O)NCC1C(C(CO1)NC2CCN(CC2)C(=O)C)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-[(1-acetyl-4-piperidinyl)amino]-1,4-anhydro-2,5-dideoxy-5-[[[(1-methylethyl)amino]carbonyl]amino]-; NAT19-551711 |