Systematic / IUPAC Name: 1-[[(2R,3S,4R)-4-(Dimethylamino)-3-hydroxyoxolan-2-yl]methyl]-3-phenylurea
ID: Reference11937
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-(dimethylamino)-5-[[(phenylamino)carbonyl]amino]-;
NAT19-551903
Formula: C14H21N3O3
1,4-Anhydro-2,5-dideoxy-2-(dimethylamino)-5-[(phenylcarbamoyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 600 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/11/2022 1:57:09 PM |
| InChI | InChI=1S/C14H21N3O3/c1-17(2)11-9-20-12(13(11)18)8-15-14(19)16-10-6-4-3-5-7-10/h3-7,11-13,18H,8-9H2,1-2H3,(H2,15,16,19)/t11-,12-,13+/m1/s1 |
| InChI Key | YCTFALHWTDITDP-UPJWGTAASA-N |
| Canonical SMILES | CN(C)C1COC(C1O)CNC(=O)NC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-(dimethylamino)-5-[[(phenylamino)carbonyl]amino]-; NAT19-551903 |
| PubChem | 75536765 |
| ChemSpider | 29858686 |
| ChEMBL | CHEMBL3436970 |