Systematic / IUPAC Name: N-[[(2R,3S,4R)-3-Hydroxy-4-(oxan-4-ylamino)oxolan-2-yl]methyl]benzenesulfonamide
ID: Reference11957
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-2-[(tetrahydro-2H-pyran-4-yl)amino]-;
NAT19-551609
Formula: C16H24N2O5S
1,4-Anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-2-(tetrahydro-2H-pyran-4-ylamino)-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2141 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/14/2022 4:08:10 PM |
| InChI | InChI=1S/C16H24N2O5S/c19-16-14(18-12-6-8-22-9-7-12)11-23-15(16)10-17-24(20,21)13-4-2-1-3-5-13/h1-5,12,14-19H,6-11H2/t14-,15-,16+/m1/s1 |
| InChI Key | MBNKSOARMLUORZ-OAGGEKHMSA-N |
| Canonical SMILES | C1COCCC1NC2COC(C2O)CNS(=O)(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-5-[(phenylsulfonyl)amino]-2-[(tetrahydro-2H-pyran-4-yl)amino]-; NAT19-551609 |