Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-Amino-3-hydroxyoxolan-2-yl]methyl]morpholine-4-carboxamide
ID: Reference11981
Other Names:
D-Arabinitol, 2-amino-1,4-anhydro-2,5-dideoxy-5-[(4-morpholinylcarbonyl)amino]-;
NAT19-551852
Formula: C10H19N3O4
2-Amino-1,4-anhydro-2,5-dideoxy-5-[(4-morpholinylcarbonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 414 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/21/2022 3:54:59 PM |
| InChI | InChI=1S/C10H19N3O4/c11-7-6-17-8(9(7)14)5-12-10(15)13-1-3-16-4-2-13/h7-9,14H,1-6,11H2,(H,12,15)/t7-,8-,9+/m1/s1 |
| InChI Key | CGADBKNPQUQOIP-HLTSFMKQSA-N |
| Canonical SMILES | C1COCCN1C(=O)NCC2C(C(CO2)N)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 2-amino-1,4-anhydro-2,5-dideoxy-5-[(4-morpholinylcarbonyl)amino]-; NAT19-551852 |