Systematic / IUPAC Name: 4-[[[(3R,4S,5R)-5-(Benzamidomethyl)-4-hydroxyoxolan-3-yl]amino]methyl]benzoic acid
ID: Reference12005
Other Names:
D-Arabinitol, 1,4-anhydro-5-(benzoylamino)-2-[[(4-carboxyphenyl)methyl]amino]-2,5-dideoxy-;
NAT19-551425
Formula: C20H22N2O5
1,4-Anhydro-5-(benzoylamino)-2-[(4-carboxybenzyl)amino]-2,5-dideoxy-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2340 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2022 4:57:32 PM |
| InChI | InChI=1S/C20H22N2O5/c23-18-16(21-10-13-6-8-15(9-7-13)20(25)26)12-27-17(18)11-22-19(24)14-4-2-1-3-5-14/h1-9,16-18,21,23H,10-12H2,(H,22,24)(H,25,26)/t16-,17-,18+/m1/s1 |
| InChI Key | KPGOLUCKWXKVAW-KURKYZTESA-N |
| Canonical SMILES | C1C(C(C(O1)CNC(=O)C2=CC=CC=C2)O)NCC3=CC=C(C=C3)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-5-(benzoylamino)-2-[[(4-carboxyphenyl)methyl]amino]-2,5-dideoxy-; NAT19-551425 |