Systematic / IUPAC Name: [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate
ID: Reference1210
Other Names:
2(1H)-Pyrimidinone, 4-amino-1-(5-O-phosphono-β-D-ribofuranosyl)-;
{[(2R,3S,4R,5R)-5-(4-Amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid;
Cytidine monophosphate
Formula: C9H14N3O8P
Class: Endogenous Metabolites
Cytidine 5'-monophosphate (hydrate) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1355 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 12/4/2014 3:27:02 PM |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChI Key | IERHLVCPSMICTF-XVFCMESISA-N |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O |
| CAS | 63376 |
| Splash | |
| Other Names |
2(1H)-Pyrimidinone, 4-amino-1-(5-O-phosphono-β-D-ribofuranosyl)-; {[(2R,3S,4R,5R)-5-(4-Amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}phosphonic acid; Cytidine monophosphate |
| ChemIDPlus | 000063376; 030811804; 024939035; 025280459; 006757068; 034607233; 065048115; 074721510 |
| Wikipedia | Cytidine monophosphate |
| ChEMBL | CHEMBL307679 |
| HMDb | HMDB00095 |
| KEGG | C00055 |
| PubChem | 6131 |
| ChEBI | CHEBI:17361 |
| ChemSpider | 5901 |