Systematic / IUPAC Name: 4-(Dimethylamino)-N-[[(2R,3R,4S,5S)-4-hydroxy-5-(hydroxymethyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]oxolan-2-yl]methyl]benzamide
ID: Reference12118
Other Names:
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[4-(dimethylamino)benzoyl]amino]-4-[4-(2-methoxyphenyl)-1-piperazinyl]-;
NAT27-401493
Formula: C26H36N4O5
2,5-Anhydro-4,6-dideoxy-6-{[4-(dimethylamino)benzoyl]amino}-4-[4-(2-methoxyphenyl)-1-piperazinyl]-D-galactitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 465 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/12/2023 9:41:34 AM |
| InChI | InChI=1S/C26H36N4O5/c1-28(2)19-10-8-18(9-11-19)26(33)27-16-22-24(25(32)23(17-31)35-22)30-14-12-29(13-15-30)20-6-4-5-7-21(20)34-3/h4-11,22-25,31-32H,12-17H2,1-3H3,(H,27,33)/t22-,23+,24+,25-/m1/s1 |
| InChI Key | HRGOXYIJYXXYHW-WSOYEBOPSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCC2C(C(C(O2)CO)O)N3CCN(CC3)C4=CC=CC=C4OC |
| CAS | |
| Splash | |
| Other Names |
D-Galactitol, 2,5-anhydro-4,6-dideoxy-6-[[4-(dimethylamino)benzoyl]amino]-4-[4-(2-methoxyphenyl)-1-piperazinyl]-; NAT27-401493 |