Systematic / IUPAC Name: (2R)-2,8-Dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol
ID: Reference1212
Other Names:
δ-Tocopherol;
(+)-δ-Tocopherol;
Vitamine E;
{2R[2R*(4R*,8R*)]}-3,4-Dihydro-2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzopyran-6-ol ;
(2R)-3,4-Dihydro-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol
; more
Formula: C27H46O2
Class: Endogenous Metabolites Excipients/Additives/Colorants
D-δ-Tocopherol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 192 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 10/17/2016 1:00:04 PM |
| InChI | InChI=1S/C27H46O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(28)18-23(5)26(24)29-27/h18-22,28H,7-17H2,1-6H3/t21-,22-,27-/m1/s1 |
| InChI Key | GZIFEOYASATJEH-VHFRWLAGSA-N |
| Canonical SMILES | CC1=C2C(=CC(=C1)O)CCC(O2)(C)CCCC(C)CCCC(C)CCCC(C)C |
| CAS | 119131 |
| Splash | |
| Other Names |
δ-Tocopherol; (+)-δ-Tocopherol; Vitamine E; {2R[2R*(4R*,8R*)]}-3,4-Dihydro-2,8-dimethyl-2-(4,8,12-trimethyltridecyl)-2H-benzopyran-6-ol ; (2R)-3,4-Dihydro-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-2H-1-benzopyran-6-ol; 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,8-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-, (2R)- ; 8-Methyltocol |
| HMDb | HMDB02902 |
| ChemIDPlus | 000119131 |
| PubChem | 92094 |
| ChemSpider | 83144 |
| KEGG | C14151 |
| ChEBI | CHEBI:47772 |
| Wikipedia | Delta-Tocopherol |
| ChEMBL | CHEMBL1451395 |