Systematic / IUPAC Name: N-[[(2R,4S,5S)-4-Hydroxy-5-(hydroxymethyl)-3-(4-phenylpiperazin-1-yl)oxolan-2-yl]methyl]-1-methylpyrrole-2-carboxamide
ID: Reference12126
Other Names:
D-Glucitol, 2,5-anhydro-4,6-dideoxy-6-[[(1-methyl-1H-pyrrol-2-yl)carbonyl]amino]-4-(4-phenyl-1-piperazinyl)-;
NAT27-401047
Formula: C22H30N4O4
2,5-Anhydro-4,6-dideoxy-6-{[(1-methyl-1H-pyrrol-2-yl)carbonyl]amino}-4-(4-phenyl-1-piperazinyl)-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 885 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/13/2023 8:46:44 AM |
| InChI | InChI=1S/C22H30N4O4/c1-24-9-5-8-17(24)22(29)23-14-18-20(21(28)19(15-27)30-18)26-12-10-25(11-13-26)16-6-3-2-4-7-16/h2-9,18-21,27-28H,10-15H2,1H3,(H,23,29)/t18-,19+,20?,21-/m1/s1 |
| InChI Key | UJIGVYVTXAHSLS-JGUMPVPUSA-N |
| Canonical SMILES | CN1C=CC=C1C(=O)NCC2C(C(C(O2)CO)O)N3CCN(CC3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 2,5-anhydro-4,6-dideoxy-6-[[(1-methyl-1H-pyrrol-2-yl)carbonyl]amino]-4-(4-phenyl-1-piperazinyl)-; NAT27-401047 |