Systematic / IUPAC Name: 2-[[(3S,3aR,6R,6aS)-3-Acetamido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetamide
ID: Reference12166
Other Names:
D-Glucitol, 2-(acetylamino)-5-O-(2-amino-2-oxoethyl)-1,4:3,6-dianhydro-2-deoxy-;
NAT6-269358
Formula: C10H16N2O5
2-Acetamido-5-O-(2-amino-2-oxoethyl)-1,4:3,6-dianhydro-2-deoxy-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1328 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2023 9:46:42 AM |
| InChI | InChI=1S/C10H16N2O5/c1-5(13)12-6-2-16-10-7(3-17-9(6)10)15-4-8(11)14/h6-7,9-10H,2-4H2,1H3,(H2,11,14)(H,12,13)/t6-,7+,9+,10+/m0/s1 |
| InChI Key | VVSZIIUXNFMVAR-MVHNUAHISA-N |
| Canonical SMILES | CC(=O)NC1COC2C1OCC2OCC(=O)N |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 2-(acetylamino)-5-O-(2-amino-2-oxoethyl)-1,4:3,6-dianhydro-2-deoxy-; NAT6-269358 |