Systematic / IUPAC Name: 3-Hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
ID: Reference1219
Other Names:
Ketohydroxyestrin;
Ketohydroxyoestrin;
3-Hydroxyestra-1,3,5(10)-trien-17-one;
3-Hydroxy-17-keto-estra-1,3,5-triene;
Estra-1,3,5(10)-trien-17-one, 3-hydroxy-
; more
Formula: C18H22O2
Class: Endogenous Metabolites
Estrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 5152 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 8/21/2020 10:05:23 AM |
| InChI | InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-16,19H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1 |
| InChI Key | DNXHEGUUPJUMQT-CBZIJGRNSA-N |
| Canonical SMILES | CC12CCC3C(C1CCC2=O)CCC4=C3C=CC(=C4)O |
| CAS | 53167 |
| Splash | |
| Other Names |
Ketohydroxyestrin; Ketohydroxyoestrin; 3-Hydroxyestra-1,3,5(10)-trien-17-one; 3-Hydroxy-17-keto-estra-1,3,5-triene; Estra-1,3,5(10)-trien-17-one, 3-hydroxy-; Estra-1(10),2,4-trien-17-one, 3-hydroxy-; (8R,9S,13S,14S)-3-Hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one; 3-Hydroxyestra-1(10),2,4-trien-17-one; Folliculin; Oestrone; Theelin; Disynformon; Estrugenone; Folliculine; Follicunodis; Glandubolin; Hiestrone; Hormestrin; Kestrone; Oestroform; Thelykinin; Estron; Femidyn; Folipex; Folisan; Kolpon; Estrone-A; Crinovaryl; Cristallovar; Follestrine; Hormofollin; Hormovarine; Ketodestrin; Thelestrin; Destrone; Estrusol; Folikrin; Menformon; Oestrin; Ovifollin; Perlatan; Tokokin; Wynestron; Estrona; 1,3,5(10)-Estratrien-3-ol-17-one; Estrol; δ-1,3,5-Estratrien-3β-ol-17-one; (+)-Estrone |
| LipidsMAPs | LMST02010004 |
| ChEMBL | CHEMBL1405 |
| ChemSpider | 5660 |
| Wikipedia | Estrone |
| DrugBank | APRD00588 |
| PubChem | 5870 |
| HMDb | HMDB00145 |
| ChemIDPlus | 000053167 |
| ChEBI | CHEBI:17263 |
| KEGG | C00468; D00067 |