Systematic / IUPAC Name: (2S)-2-{[(4S)-4-amino-4-carboxybutanoyl]amino}pentanedioic acid
ID: Reference1223
Other Names:
L-Υ-Glutamyl-L-glutamic acid;
N-Υ-L-Glutamyl-L-glutamic acid;
Υ Glutamylglutamic acid;
Υ-Glutamylglutamate
Formula: C10H16N2O7
Class: Endogenous Metabolites
Υ-L-Glutamyl-L-glutamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/17/2016 1:17:31 PM |
| InChI | InChI=1S/C10H16N2O7/c11-5(9(16)17)1-3-7(13)12-6(10(18)19)2-4-8(14)15/h5-6H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)/t5-,6-/m0/s1 |
| InChI Key | OWQDWQKWSLFFFR-WDSKDSINSA-N |
| Canonical SMILES | O=C(NC(C(=O)O)CCC(=O)O)CCC(C(=O)O)N |
| CAS | 1116229 |
| Splash | |
| Other Names |
L-Υ-Glutamyl-L-glutamic acid; N-Υ-L-Glutamyl-L-glutamic acid; Υ Glutamylglutamic acid; Υ-Glutamylglutamate |