Systematic / IUPAC Name: (2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoic acid
ID: Reference1226
Other Names:
Pentahydroxycaproic acid;
Pentahydroxycaproate;
Gluconic acid;
Dextronic acid;
Maltonic acid
; more
Formula: C6H12O7
Class: Endogenous Metabolites
Gluconic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 182 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 2:47:34 PM |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 |
| InChI Key | RGHNJXZEOKUKBD-SQOUGZDYSA-N |
| Canonical SMILES | C(C(C(C(C(C(=O)O)O)O)O)O)O |
| CAS | 526954 |
| Splash | |
| Other Names |
Pentahydroxycaproic acid; Pentahydroxycaproate; Gluconic acid; Dextronic acid; Maltonic acid; Glycogenic acid; Gluconate; Dextronate; Glyconate; Maltonate |
| ChEMBL | CHEMBL464345 |
| HMDb | HMDB00625 |
| ChemIDPlus | 000299274; 000299285; 000526954; 000527093; 004468024; 006485398; 018472510; 035087775; 083542863; 014906979 |
| ChemSpider | 10240 |
| ChEBI | CHEBI:33198 |
| KEGG | C08038; C11852; C12278; C13511; D00642; D00858; D00935; D01298; D02010; D02390 |
| PubChem | 10690 |
| Wikipedia | Gluconic acid |