Systematic / IUPAC Name: [[(2R,3S,4R,5R)-5-(2-Amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
ID: Reference1227
Other Names:
6H-Purin-6-one, 2-amino-1,9-dihydro-9-[5-O-[hydroxy[[hydroxy(phosphonooxy)phosphinyl]oxy]phosphinyl]-β-D-ribofuranosyl]-;
Guanosine triphosphate;
GTP
Formula: C10H16N5O14P3
Class: Endogenous Metabolites
Guanosine triphosphate (GTP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1957 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 2:45:07 PM |
| InChI | InChI=1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChI Key | XKMLYUALXHKNFT-UUOKFMHZSA-N |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)NC(=NC2=O)N |
| CAS | 86011 |
| Splash | |
| Other Names |
6H-Purin-6-one, 2-amino-1,9-dihydro-9-[5-O-[hydroxy[[hydroxy(phosphonooxy)phosphinyl]oxy]phosphinyl]-β-D-ribofuranosyl]-; Guanosine triphosphate; GTP |
| ChemIDPlus | 113903198 |
| Wikipedia | Guanosine triphosphate |
| ChemSpider | 6569 |
| PubChem | 762 |