Systematic / IUPAC Name: 2-Amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,9-dihydro-1H-purin-6-one
ID: Reference1228
Other Names:
Inosine, 2-amino-;
2(3H)-Imino-9-β-D-ribofuranosyl-9H-purin-6(1H)-one;
6H-Purin-6-one, 2-amino-1,9-dihydro-9-β-D-ribofuranosyl-;
2-Amino-9-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one;
2-Amino-9-β-D-ribofuranosyl-9H-purine-6-1H-one
; more
Formula: C10H13N5O5
Class: Endogenous Metabolites
Guanosine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 475 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/4/2014 2:38:46 PM |
| InChI | InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1 |
| InChI Key | NYHBQMYGNKIUIF-UUOKFMHZSA-N |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)NC(=NC2=O)N |
| CAS | 118003 |
| Splash | |
| Other Names |
Inosine, 2-amino-; 2(3H)-Imino-9-β-D-ribofuranosyl-9H-purin-6(1H)-one; 6H-Purin-6-one, 2-amino-1,9-dihydro-9-β-D-ribofuranosyl-; 2-Amino-9-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one; 2-Amino-9-β-D-ribofuranosyl-9H-purine-6-1H-one; 2-Amino-1,9-dihydro-9-β-δ-ribofuranosyl-6H-purin-6-one; Guanine riboside; Vernine; Guanine, 9-β-D-ribofuranosyl-; Ribofuranoside, guanine-9, β-D-; GUO; Guanine-9-β-D-ribofuranoside; 9-(β-D-Ribofuranosyl)guanine |
| ChemIDPlus | 000118003; 000085303 |
| KEGG | C00387 |
| ChEMBL | CHEMBL375655 |
| PubChem | 6802 |
| ChemSpider | 6544 |
| Wikipedia | Guanosine |
| HMDb | HMDB00133 |
| ChEBI | CHEBI:16750 |