Systematic / IUPAC Name: (Z)-2-Chloro-1-(2,4-dichlorophenyl)vinyl diethyl phosphate
ID: Reference1233
Other Names:
2-Chloro-1-(2,4-dichlorophenyl)vinyldiethylphosphate;
Diethyl-1-(2,4-dichlorophenyl)-2-chlorovinyl phosphate;
Diethyl-2-chloro-1-(2,4-dichlorophenyl)vinyl phosphate;
2,4-Dichloro-α-(chloromethylene)benzyl alcohol diethyl phosphate;
Benzyl alcohol, 2,4-dichloro-α-(chloromethylene)-, diethyl phosphate
; more
Formula: C12H14Cl3O4P
Class: Pesticides/Herbicides
Chlorfenvinphos mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 973 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 2:28:53 PM |
| InChI | InChI=1S/C12H14Cl3O4P/c1-3-17-20(16,18-4-2)19-12(8-13)10-6-5-9(14)7-11(10)15/h5-8H,3-4H2,1-2H3/b12-8- |
| InChI Key | FSAVDKDHPDSCTO-WQLSENKSSA-N |
| Canonical SMILES | CCOP(=O)(OCC)OC(=CCl)C1=C(C=C(C=C1)Cl)Cl |
| CAS | 470906 |
| Splash | |
| Other Names |
2-Chloro-1-(2,4-dichlorophenyl)vinyldiethylphosphate; Diethyl-1-(2,4-dichlorophenyl)-2-chlorovinyl phosphate; Diethyl-2-chloro-1-(2,4-dichlorophenyl)vinyl phosphate; 2,4-Dichloro-α-(chloromethylene)benzyl alcohol diethyl phosphate; Benzyl alcohol, 2,4-dichloro-α-(chloromethylene)-, diethyl phosphate; Phosphoric acid, 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester; Phosphoric acid, (1Z)-2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester; Chlorfenvinfos; Birlane; Dermaton; Chlorphenvinphos; Clofenvinfos; Chlofenvinphos; Chlorphenvinfos; Clorfenvinfos; Apachlor; Enolofos; Haptarax; Haptasol; Sapecron; Steladone; Vinyphate; Birlan; Tarene; Chlorofenvinphos; Birlane 10G; Supona |
| Wikipedia | Chlorfenvinphos |
| ChemIDPlus | 000470906; 018708877; 135373330 |
| PubChem | 5377784 |
| ChEMBL | CHEMBL2104653 |
| ChemSpider | 4526760 |