Systematic / IUPAC Name: N-[(3S,3aR,6R,6aS)-6-Methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclobutanecarboxamide
ID: Reference12341
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-[(cyclobutylcarbonyl)amino]-2-deoxy-5-O-methyl-;
NAT6-269558
Formula: C12H19NO4
1,4:3,6-Dianhydro-2-[(cyclobutylcarbonyl)amino]-2-deoxy-5-O-methyl-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 648 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/7/2023 11:37:02 AM |
| InChI | InChI=1S/C12H19NO4/c1-15-9-6-17-10-8(5-16-11(9)10)13-12(14)7-3-2-4-7/h7-11H,2-6H2,1H3,(H,13,14)/t8-,9+,10+,11+/m0/s1 |
| InChI Key | GZZUDGVEGOEWHS-LNFKQOIKSA-N |
| Canonical SMILES | COC1COC2C1OCC2NC(=O)C3CCC3 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-[(cyclobutylcarbonyl)amino]-2-deoxy-5-O-methyl-; NAT6-269558 |