Systematic / IUPAC Name: 2,2-Difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]acetic acid
ID: Reference12389
Other Names:
Perfluoro-3,6,9-trioxadecanoic acid;
Acetic acid,2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]-
Formula: C7HF13O5
Class: Perfluorinated Hydrocarbons
Difluoro{1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion |
| No. of Spectral Trees | 1 |
| No. of Spectra | 205 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/17/2023 10:43:15 AM |
| InChI | InChI=1S/C7HF13O5/c8-2(9,1(21)22)23-3(10,11)4(12,13)24-5(14,15)6(16,17)25-7(18,19)20/h(H,21,22) |
| InChI Key | GNQWOKPKDHCUSB-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(OC(C(OC(C(OC(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 151772597 |
| Splash | |
| Other Names |
Perfluoro-3,6,9-trioxadecanoic acid; Acetic acid,2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]- |