Systematic / IUPAC Name: (E)-2,3,4,5,5,5-Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid
ID: Reference12390
Other Names:
(E)-Perfluoro(4-methylpent-2-enoic acid);
(2E)-2,3,4,5,5,5-Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid;
4-(Trifluoromethyl)hexafluoropent-2-enoic acid;
Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid;
Perfluoro(4-methylpent-2-enoic acid)
Formula: C6HF9O2
Class: Perfluorinated Hydrocarbons
(2E)-2,3,4,5,5,5-Hexafluoro-4-(trifluoromethyl)-2-pentenoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion |
| No. of Spectral Trees | 1 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2023 12:24:13 PM |
| InChI | InChI=1S/C6HF9O2/c7-1(3(16)17)2(8)4(9,5(10,11)12)6(13,14)15/h(H,16,17)/b2-1+ |
| InChI Key | TWDHAMRDYDLSPH-OWOJBTEDSA-N |
| Canonical SMILES | C(=C(C(C(F)(F)F)(C(F)(F)F)F)F)(C(=O)O)F |
| CAS | 103229896 |
| Splash | |
| Other Names |
(E)-Perfluoro(4-methylpent-2-enoic acid); (2E)-2,3,4,5,5,5-Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid; 4-(Trifluoromethyl)hexafluoropent-2-enoic acid; Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid; Perfluoro(4-methylpent-2-enoic acid) |