Systematic / IUPAC Name: 2,2,3,3,4,4,5,5-Octafluorohexanedioic acid
ID: Reference12396
Other Names:
Perfluoroadipic acid;
Hexanedioic acid, 2,2,3,3,4,4,5,5-octafluoro-;
Hexanedioic acid, octafluoro-;
Octafluorohexanedioic acid
Formula: C6H2F8O4
Class: Perfluorinated Hydrocarbons
Octafluoroadipic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion |
| No. of Spectral Trees | 1 |
| No. of Spectra | 496 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2023 3:11:05 PM |
| InChI | InChI=1S/C6H2F8O4/c7-3(8,1(15)16)5(11,12)6(13,14)4(9,10)2(17)18/h(H,15,16)(H,17,18) |
| InChI Key | AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 336083 |
| Splash | |
| Other Names |
Perfluoroadipic acid; Hexanedioic acid, 2,2,3,3,4,4,5,5-octafluoro-; Hexanedioic acid, octafluoro-; Octafluorohexanedioic acid |
| PubChem | 67640 |
| ChemIDPlus | 000336083 |
| ChemSpider | 60959 |
| ChEMBL | CHEMBL1741942 |