Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorodecanedioic acid
ID: Reference12397
Other Names:
Hexadecafluorosebacic acid;
Decanedioic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-;
Decanedioic acid, hexadecafluoro-;
Hexadecafluorodecanedioic acid;
Perfluorodecanedioic acid
Formula: C10H2F16O4
Class: Perfluorinated Hydrocarbons
Perfluorosebacic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion |
| No. of Spectral Trees | 1 |
| No. of Spectra | 205 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2023 3:18:24 PM |
| InChI | InChI=1S/C10H2F16O4/c11-3(12,1(27)28)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2(29)30/h(H,27,28)(H,29,30) |
| InChI Key | YPCSMEGZIYWAAZ-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 307788 |
| Splash | |
| Other Names |
Hexadecafluorosebacic acid; Decanedioic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-; Decanedioic acid, hexadecafluoro-; Hexadecafluorodecanedioic acid; Perfluorodecanedioic acid |