Systematic / IUPAC Name: N5-Carbamoyl-L-ornithine
ID: Reference1240
Other Names:
L-Ornithine, N5-(aminocarbonyl)-;
N5-(Aminocarbonyl)-L-ornithine;
(2S)-2-Amino-5-(carbamoylamino)pentanoic acid;
(S)-2-Amino-5-(aminocarbonyl)aminopentanoic acid;
(S)-2-Amino-5-ureidopentanoic acid
; more
Formula: C6H13N3O3
Class: Endogenous Metabolites
L-(+)-Citrulline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 502 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 2:06:38 PM |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
| InChI Key | RHGKLRLOHDJJDR-UHFFFAOYSA-N |
| Canonical SMILES | C(CC(C(=O)O)N)CNC(=O)N |
| CAS | 372758 |
| Splash | |
| Other Names |
L-Ornithine, N5-(aminocarbonyl)-; N5-(Aminocarbonyl)-L-ornithine; (2S)-2-Amino-5-(carbamoylamino)pentanoic acid; (S)-2-Amino-5-(aminocarbonyl)aminopentanoic acid; (S)-2-Amino-5-ureidopentanoic acid; 2-Amino-5-ureidovaleric acid; L-(+)-2-Amino-5-ureidovaleric acid; L-2-Amino-5-ureidovaleric acid; Ornithine, N-5-(aminocarbonyl)-; Ureidovaleric acid; α-Amino-Υ-ureidovaleric acid; L-Citrulline; Citrulline; Citrulline, L-; N5-Carbamoylornithine |
| KEGG | C00327; D07706 |
| PubChem | 9750 |
| ChemIDPlus | 000372758 |
| ChEMBL | CHEMBL444814 |
| ChemSpider | 810 |
| Wikipedia | Citrulline |
| ChEBI | CHEBI:16349; CHEBI:57743 |
| HMDb | HMDB00904 |