Systematic / IUPAC Name: 2,2,3,3-Tetrafluoro-3-(trifluoromethoxy)propanoic acid
ID: Reference12404
Other Names:
2,2,3,3-Tetrafluoro-3-(trifluoromethoxy)propionic acid;
Perfluoromethoxyperfluoropropionic acid;
Perfluoromethoxypropionic acid;
Propionic acid, 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)-
Formula: C4HF7O3
Class: Perfluorinated Hydrocarbons
Perfluoro-3-methoxypropanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 727 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/21/2023 4:17:18 PM |
| InChI | InChI=1S/C4HF7O3/c5-2(6,1(12)13)3(7,8)14-4(9,10)11/h(H,12,13) |
| InChI Key | AGIMOOYNBDLMJV-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(OC(F)(F)F)(F)F)(F)F)O |
| CAS | 377731 |
| Splash | |
| Other Names |
2,2,3,3-Tetrafluoro-3-(trifluoromethoxy)propionic acid; Perfluoromethoxyperfluoropropionic acid; Perfluoromethoxypropionic acid; Propionic acid, 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)- |