Systematic / IUPAC Name: (2R,3R)-2,3-Dihydroxysuccinic acid
ID: Reference1245
Other Names:
(2R,3R)-2,3-Dihydroxybutanedioic acid;
1,2-Dihydroxyethane-1,2-dicarboxylic acid;
(2R,3R)-2,3-Dihydroxybutanedioate;
L-2,3-Dihydroxybutanedioic acid;
(R,R)-Tartaric acid
; more
Formula: C4H6O6
Class: Endogenous Metabolites
L-(+)-Tartaric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 435 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 3/2/2026 9:19:46 AM |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChI Key | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| Canonical SMILES | C(C(C(=O)O)O)(C(=O)O)O |
| CAS | 87694 |
| Splash | |
| Other Names |
(2R,3R)-2,3-Dihydroxybutanedioic acid; 1,2-Dihydroxyethane-1,2-dicarboxylic acid; (2R,3R)-2,3-Dihydroxybutanedioate; L-2,3-Dihydroxybutanedioic acid; (R,R)-Tartaric acid; (2R,3R)-(+)-Tartaric acid; L-Tartarate; (+)-(2R,3R)-Tartaric acid |
| ChEMBL | CHEMBL1236315 |
| ChemSpider | 392277 |
| PubChem | 444305 |
| Wikipedia | Tartaric acid |
| HMDb | HMDB00956 |
| KEGG | D00679; D00837; D00103; D01561; D01850; D01852; D02238; D03825; D02836; D02981 |
| ChemIDPlus | 000147784; 000302318; 000304596; 000815781; 000868144; 000868166; 000868177; 001405545; 006190381; 017692158 |
| ChEBI | CHEBI:15671 |