Systematic / IUPAC Name: [(3S,3aR,6R,6aS)-3-[(4-Acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate
ID: Reference12485
Other Names:
D-Glucitol, 2-[[[(4-acetylphenyl)amino]carbonyl]amino]-1,4:3,6-dianhydro-2-deoxy-, 5-(1-naphthalenylcarbamate);
NAT6-269972
Formula: C26H25N3O6
2-{[(4-Acetylphenyl)carbamoyl]amino}-1,4:3,6-dianhydro-2-deoxy-5-O-(1-naphthylcarbamoyl)-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1819 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/4/2023 9:32:48 AM |
| InChI | InChI=1S/C26H25N3O6/c1-15(30)16-9-11-18(12-10-16)27-25(31)28-21-13-33-24-22(14-34-23(21)24)35-26(32)29-20-8-4-6-17-5-2-3-7-19(17)20/h2-12,21-24H,13-14H2,1H3,(H,29,32)(H2,27,28,31)/t21-,22+,23+,24+/m0/s1 |
| InChI Key | GTPBPLNQXSTPHU-OLKYXYMISA-N |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)NC2COC3C2OCC3OC(=O)NC4=CC=CC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 2-[[[(4-acetylphenyl)amino]carbonyl]amino]-1,4:3,6-dianhydro-2-deoxy-, 5-(1-naphthalenylcarbamate); NAT6-269972 |