Systematic / IUPAC Name: [(3S,3aR,6R,6aS)-3-[4-(Methoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate
ID: Reference12494
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-2-[4-(methoxymethyl)-1H-1,2,3-triazol-1-yl]-, 5-[[3-(trifluoromethyl)phenyl]carbamate];
NAT6-305149
Formula: C18H19F3N4O5
1,4:3,6-Dianhydro-2-deoxy-2-[4-(methoxymethyl)-1H-1,2,3-triazol-1-yl]-5-O-{[3-(trifluoromethyl)phenyl]carbamoyl}-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1366 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/27/2023 2:23:36 PM |
| InChI | InChI=1S/C18H19F3N4O5/c1-27-7-12-6-25(24-23-12)13-8-28-16-14(9-29-15(13)16)30-17(26)22-11-4-2-3-10(5-11)18(19,20)21/h2-6,13-16H,7-9H2,1H3,(H,22,26)/t13-,14+,15+,16+/m0/s1 |
| InChI Key | UHYPVUMCRUIYJF-ZJIFWQFVSA-N |
| Canonical SMILES | COCC1=CN(N=N1)C2COC3C2OCC3OC(=O)NC4=CC=CC(=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-2-[4-(methoxymethyl)-1H-1,2,3-triazol-1-yl]-, 5-[[3-(trifluoromethyl)phenyl]carbamate]; NAT6-305149 |