Systematic / IUPAC Name: 2-Amino-3-(1-methylimidazol-4-yl)propanoic acid
ID: Reference125
Other Names:
L-Histidine, 1-methyl-;
1-Methyl-DL-histidine;
2-Amino-3-(1-methyl-1H-imidazol-4-yl)propanoic acid
Formula: C7H11N3O2
Class: Endogenous Metabolites
1-Methylhistidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 299 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/5/2014 1:34:07 PM |
| InChI | InChI=1S/C7H11N3O2/c1-10-3-5(9-4-10)2-6(8)7(11)12/h3-4,6H,2,8H2,1H3,(H,11,12) |
| InChI Key | BRMWTNUJHUMWMS-UHFFFAOYSA-N |
| Canonical SMILES | CN1C=C(N=C1)CC(C(=O)O)N |
| CAS | 332809 |
| Splash | |
| Other Names |
L-Histidine, 1-methyl-; 1-Methyl-DL-histidine; 2-Amino-3-(1-methyl-1H-imidazol-4-yl)propanoic acid |
| ChEMBL | CHEMBL45557 |
| Wikipedia | Histidine |
| KEGG | C01152 |
| ChemSpider | 312567 |
| PubChem | 352019 |
| ChEBI | CHEBI:70958 |