Systematic / IUPAC Name: (3S,3aR,6R,6aR)-3-[5-(4-Phenylphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol
ID: Reference12508
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-(5-[1,1'-biphenyl]-4-yl-1H-tetrazol-1-yl)-2-deoxy-;
NAT6-296397
Formula: C19H18N4O3
1,4:3,6-Dianhydro-2-[5-(4-biphenylyl)-1H-tetrazol-1-yl]-2-deoxy-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1280 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/4/2023 11:53:51 AM |
| InChI | InChI=1S/C19H18N4O3/c24-16-11-26-17-15(10-25-18(16)17)23-19(20-21-22-23)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-18,24H,10-11H2/t15-,16+,17+,18+/m0/s1 |
| InChI Key | MEKYWEJRENQVCP-BSDSXHPESA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)O)N3C(=NN=N3)C4=CC=C(C=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-(5-[1,1'-biphenyl]-4-yl-1H-tetrazol-1-yl)-2-deoxy-; NAT6-296397 |