Systematic / IUPAC Name: 2-Methoxybenzoic acid
ID: Reference1252
Other Names:
o-Anisic acid ;
2-Carboxyanisole;
o-Methoxybenzoic acid;
Benzoic acid, 2-methoxy-;
Salicylic acid methyl ether
Formula: C8H8O3
Class: Endogenous Metabolites Excipients/Additives/Colorants
2-Anisic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 1263 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 10/7/2015 11:02:49 AM |
| InChI | InChI=1S/C8H8O3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChI Key | ILUJQPXNXACGAN-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC=C1C(=O)O |
| CAS | 529759 |
| Splash | |
| Other Names |
o-Anisic acid ; 2-Carboxyanisole; o-Methoxybenzoic acid; Benzoic acid, 2-methoxy-; Salicylic acid methyl ether |
| ChemSpider | 10892 |
| ChEBI | CHEBI:421840 |
| ChEMBL | CHEMBL192311 |
| ChemIDPlus | 000579759; 050671573 |
| HMDb | HMDB32604 |
| Wikipedia | O-Anisic_acid |
| PubChem | 11370 |