Systematic / IUPAC Name: [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl phosphate
ID: Reference1253
Other Names:
dAMP;
Deoxyadenylic acid;
Deoxyadenosine monophosphate;
9H-Purin-6-amine, 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-
Formula: C10H14N5O6P
Class: Endogenous Metabolites
2'-Deoxyadenosine 5'-monophosphate (dAMP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1254 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/25/2026 6:25:36 PM |
| InChI | InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
| InChI Key | KHWCHTKSEGGWEX-RRKCRQDMSA-N |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=CN=C3N)COP(=O)(O)O)O |
| CAS | 1927317 |
| Splash | |
| Other Names |
dAMP; Deoxyadenylic acid; Deoxyadenosine monophosphate; 9H-Purin-6-amine, 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)- |
| KEGG | C00360 |
| HMDb | HMDB00905 |
| ChEMBL | CHEMBL1206239 |
| ChEBI | CHEBI:17713 |
| ChemIDPlus | 000653634; 025191202 |
| Wikipedia | Deoxyadenosine_monophosphate |
| ChemSpider | 12079 |
| PubChem | 12599 |