Systematic / IUPAC Name: (9Z)-9-Hexadecenoic acid
ID: Reference1256
Other Names:
Oleopalmitic acid;
9-cis-Hexadecenoic acid;
Hexadecenoic acid;
cis-Palmitoleic acid;
(Z)-Palmitoleic acid
; more
Formula: C16H30O2
Class: Endogenous Metabolites
Palmitoleic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 406 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 7/26/2017 7:10:50 AM |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7- |
| InChI Key | SECPZKHBENQXJG-FPLPWBNLSA-N |
| Canonical SMILES | |
| CAS | 373499 |
| Splash | |
| Other Names |
Oleopalmitic acid; 9-cis-Hexadecenoic acid; Hexadecenoic acid; cis-Palmitoleic acid; (Z)-Palmitoleic acid; Zoomeric acid; 9-Hexadecenoate; Palmitoleate; 9-cis-Hexadecenoate; cis-9-Hexadecenoate; cis-δ-9-Hexadecenoic acid; 9-Hexadecenoic acid, (Z)- |
| PubChem | 445638 |
| KEGG | C08362 |
| Wikipedia | Palmitoleic_acid |
| ChEBI | CHEBI:28716 |
| ChemIDPlus | 067627672 |
| ChEMBL | CHEMBL453509 |
| HMDb | HMDB03229; HMDB60082 |
| LipidsMAPs | LMFA01030056 |
| ChemSpider | 393216 |