Systematic / IUPAC Name: N-[[(2R,3S,4R)-3-Hydroxy-4-[(1-methylimidazol-2-yl)methylamino]oxolan-2-yl]methyl]thiophene-2-carboxamide
ID: Reference12577
Other Names:
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(1-methyl-1H-imidazol-2-yl)methyl]amino]-5-[(2-thienylcarbonyl)amino]-;
NAT19-551334
Formula: C15H20N4O3S
1,4-Anhydro-2,5-dideoxy-2-{[(1-methyl-1H-imidazol-2-yl)methyl]amino}-5-[(2-thienylcarbonyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 314 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/5/2023 2:41:17 PM |
| InChI | InChI=1S/C15H20N4O3S/c1-19-5-4-16-13(19)8-17-10-9-22-11(14(10)20)7-18-15(21)12-3-2-6-23-12/h2-6,10-11,14,17,20H,7-9H2,1H3,(H,18,21)/t10-,11-,14+/m1/s1 |
| InChI Key | NMHDJQGCTKATFU-GYSYKLTISA-N |
| Canonical SMILES | CN1C=CN=C1CNC2COC(C2O)CNC(=O)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-2,5-dideoxy-2-[[(1-methyl-1H-imidazol-2-yl)methyl]amino]-5-[(2-thienylcarbonyl)amino]-; NAT19-551334 |