Systematic / IUPAC Name: N-[[(2R,3S,4R)-4-(2,2-Dimethylpropylamino)-3-hydroxyoxolan-2-yl]methyl]cyclopentanecarboxamide
ID: Reference12582
Other Names:
D-Arabinitol, 1,4-anhydro-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-2-[(2,2-dimethylpropyl)amino]-;
NAT19-551214
Formula: C16H30N2O3
1,4-Anhydro-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-2-[(2,2-dimethylpropyl)amino]-D-arabinitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1230 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/8/2023 8:38:55 AM |
| InChI | InChI=1S/C16H30N2O3/c1-16(2,3)10-18-12-9-21-13(14(12)19)8-17-15(20)11-6-4-5-7-11/h11-14,18-19H,4-10H2,1-3H3,(H,17,20)/t12-,13-,14+/m1/s1 |
| InChI Key | WRKFIVYENGCYPA-MCIONIFRSA-N |
| Canonical SMILES | CC(C)(C)CNC1COC(C1O)CNC(=O)C2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
D-Arabinitol, 1,4-anhydro-5-[(cyclopentylcarbonyl)amino]-2,5-dideoxy-2-[(2,2-dimethylpropyl)amino]-; NAT19-551214 |
| ChemSpider | 29858445 |
| PubChem | 75367072 |
| ChEMBL | CHEMBL3437007 |