Systematic / IUPAC Name: [(2R,3S,4R,5R)-5-(2,4-Dioxo-3,4-dihydro-1(2H)-pyrimidinyl)-3,4-dihydroxytetrahydro-2-furanyl]methyl (2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl diphosphate
ID: Reference1260
Other Names:
Uridine diphosphate-δ-galactose;
Uridine pyrophosphate α-δ-galactopyranosyl ester;
UDP galactose;
UDP-α-D-galactopyranose;
Uridine pyrophosphate, α-D-galactopyranosyl ester
Formula: C15H24N2O17P2
Class: Endogenous Metabolites
Uridine 5'-diphosphogalactose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3935 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/22/2025 12:24:33 PM |
| InChI | InChI=1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8+,9-,10+,11-,12-,13-,14-/m1/s1 |
| InChI Key | HSCJRCZFDFQWRP-ABVWGUQPSA-N |
| Canonical SMILES | O=C1\C=C/N(C(=O)N1)C2OC(C(O)C2O)COP(=O)(O)OP(=O)(O)OC3OC(C(O)C(O)C3O)CO |
| CAS | 2956163 |
| Splash | |
| Other Names |
Uridine diphosphate-δ-galactose; Uridine pyrophosphate α-δ-galactopyranosyl ester; UDP galactose; UDP-α-D-galactopyranose; Uridine pyrophosphate, α-D-galactopyranosyl ester |
| HMDb | HMDB00302 |
| ChEBI | CHEBI:67119 |
| ChemSpider | 17069 |
| Wikipedia | Uridine diphosphate galactose |
| ChemIDPlus | 002956163 |
| ChEMBL | CHEMBL439009 |
| PubChem | 18068 |