Systematic / IUPAC Name: 2,3-Pyridinedicarboxylic acid
ID: Reference1262
Other Names:
Pyridine-2,3-dicarboxylic acid;
Pyridine-2,3-carboxylate
Formula: C7H5NO4
Class: Endogenous Metabolites
Quinolinic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1325 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 12:54:03 PM |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-8-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChI Key | GJAWHXHKYYXBSV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(N=C1)C(=O)O)C(=O)O |
| CAS | 89009 |
| Splash | |
| Other Names |
Pyridine-2,3-dicarboxylic acid; Pyridine-2,3-carboxylate |
| HMDb | HMDB00232 |
| PubChem | 1066 |
| KEGG | C03722 |
| ChEMBL | CHEMBL286204 |
| ChemSpider | 1037 |
| Wikipedia | Quinolinic acid |
| ChEBI | CHEBI:16675 |
| ChemIDPlus | 000089009; 018970622; 087314996 |